C8H12F4O2 — CID 88981405
1-fluoroethyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 88981405) has the molecular formula C8H12F4O2 and a molecular weight of 216.17 g/mol. Its IUPAC name is 1-fluoroethyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | 1-fluoroethyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 88981405 |
| Molecular Formula | C8H12F4O2 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-fluoroethyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F4O2/c1-4-7(3,8(10,11)12)6(13)14-5(2)9/h5H,4H2,1-3H3 |
| InChIKey | FQYCREYHJPFITI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |