About 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium)
2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) (PubChem CID 21063652) has the molecular formula C6H9F3O2Y2
and a molecular weight of 347.94 g/mol. Its IUPAC name is 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium).
Molecular Properties
| Compound Name | 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) |
| PubChem CID | 21063652 |
| Molecular Formula | C6H9F3O2Y2 |
| Molecular Weight | 347.94 g/mol |
| Exact Mass | 347.87 |
| IUPAC Name | 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) |
| SMILES | CCC(C)(C(=O)O)C(F)(F)F.[Y].[Y] |
| InChI | InChI=1S/C6H9F3O2.2Y/c1-3-5(2,4(10)11)6(7,8)9;;/h3H2,1-2H3,(H,10,11);; |
| InChIKey | ZZNCKMQUIDGPFD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.94 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium)?
The IUPAC name of 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) (CID 21063652) is 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium).
What is the SMILES notation for 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium)?
The canonical SMILES for 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) is CCC(C)(C(=O)O)C(F)(F)F.[Y].[Y].
What is the InChIKey of 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium)?
The InChIKey is ZZNCKMQUIDGPFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O2.2Y/c1-3-5(2,4(10)11)6(7,8)9;;/h3H2,1-2H3,(H,10,11);;.
What are the key properties of 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium)?
2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) has a molecular weight of 347.94 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(trifluoromethyl)butanoic acid;bis(yttrium) is sourced from PubChem (CID 21063652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).