About 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid
1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid (PubChem CID 91283214) has the molecular formula C18H35F3O3
and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid.
Molecular Properties
| Compound Name | 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid |
| PubChem CID | 91283214 |
| Molecular Formula | C18H35F3O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid |
| SMILES | CCC(C)(C(=O)O)C(F)(F)F.CCCCCCCCOC(C)CC |
| InChI | InChI=1S/C12H26O.C6H9F3O2/c1-4-6-7-8-9-10-11-13-12(3)5-2;1-3-5(2,4(10)11)6(7,8)9/h12H,4-11H2,1-3H3;3H2,1-2H3,(H,10,11) |
| InChIKey | NJHUCWZWWJJPEV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid?
The IUPAC name of 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid (CID 91283214) is 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid.
What is the SMILES notation for 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid?
The canonical SMILES for 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid is CCC(C)(C(=O)O)C(F)(F)F.CCCCCCCCOC(C)CC.
What is the InChIKey of 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid?
The InChIKey is NJHUCWZWWJJPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.C6H9F3O2/c1-4-6-7-8-9-10-11-13-12(3)5-2;1-3-5(2,4(10)11)6(7,8)9/h12H,4-11H2,1-3H3;3H2,1-2H3,(H,10,11).
What are the key properties of 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid?
1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid has a molecular weight of 356.47 g/mol, XLogP of 6.21, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yloxyoctane;2-methyl-2-(trifluoromethyl)butanoic acid is sourced from PubChem (CID 91283214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).