C13H24I2NO3- — CID 147043367
cyclohexyloxymethyl 2-iodo-2-methyl-3-(methyliodanuidylamino)butanoate (PubChem CID 147043367) has the molecular formula C13H24I2NO3- and a molecular weight of 496.15 g/mol. Its IUPAC name is cyclohexyloxymethyl 2-iodo-2-methyl-3-(methyliodanuidylamino)butanoate.
| Compound Name | cyclohexyloxymethyl 2-iodo-2-methyl-3-(methyliodanuidylamino)butanoate |
|---|---|
| PubChem CID | 147043367 |
| Molecular Formula | C13H24I2NO3- |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | cyclohexyloxymethyl 2-iodo-2-methyl-3-(methyliodanuidylamino)butanoate |
| SMILES | C[I-]NC(C)C(C)(I)C(=O)OCOC1CCCCC1 |
| InChI | InChI=1S/C13H24I2NO3/c1-10(16-15-3)13(2,14)12(17)19-9-18-11-7-5-4-6-8-11/h10-11,16H,4-9H2,1-3H3/q-1 |
| InChIKey | YORIHLBQUBJYBI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|