C26H36N4O2 — CID 164916974
ethane;4-[4-(4-hydroxybutyl)triazol-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 164916974) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is ethane;4-[4-(4-hydroxybutyl)triazol-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | ethane;4-[4-(4-hydroxybutyl)triazol-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 164916974 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | ethane;4-[4-(4-hydroxybutyl)triazol-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CC.CN(C)C(=O)C(CCn1cc(CCCCO)nn1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O2.C2H6/c1-27(2)23(30)24(20-11-5-3-6-12-20,21-13-7-4-8-14-21)16-17-28-19-22(25-26-28)15-9-10-18-29;1-2/h3-8,11-14,19,29H,9-10,15-18H2,1-2H3;1-2H3 |
| InChIKey | LXDMELQVUCPPFB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|