About 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol
3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol (PubChem CID 116790421) has the molecular formula C13H15F2N3O
and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol |
| PubChem CID | 116790421 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol |
| SMILES | OCCCc1cn(CC(F)(F)c2ccccc2)nn1 |
| InChI | InChI=1S/C13H15F2N3O/c14-13(15,11-5-2-1-3-6-11)10-18-9-12(16-17-18)7-4-8-19/h1-3,5-6,9,19H,4,7-8,10H2 |
| InChIKey | SNMGEMDRQQDVAU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol?
The IUPAC name of 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol (CID 116790421) is 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol.
What is the SMILES notation for 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol?
The canonical SMILES for 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol is OCCCc1cn(CC(F)(F)c2ccccc2)nn1.
What is the InChIKey of 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol?
The InChIKey is SNMGEMDRQQDVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3O/c14-13(15,11-5-2-1-3-6-11)10-18-9-12(16-17-18)7-4-8-19/h1-3,5-6,9,19H,4,7-8,10H2.
What are the key properties of 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol?
3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol has a molecular weight of 267.28 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,2-difluoro-2-phenylethyl)triazol-4-yl]propan-1-ol is sourced from PubChem (CID 116790421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).