ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate

C9H13F2N3O3 — CID 165487903

IUPACethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate
SMILESCCOC(=O)C(F)(F)Cn1cc(CCO)nn1
InChIInChI=1S/C9H13F2N3O3/c1-2-17-8(16)9(10,11)6-14-5-7(3-4-15)12-13-14/h5,15H,2-4,6H2,1H3
InChIKeyLPLMZFFHXVGQMP-UHFFFAOYSA-N
MW249.22 g/mol
LogP0.01
Rot. Bonds6

About ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate

ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate (PubChem CID 165487903) has the molecular formula C9H13F2N3O3 and a molecular weight of 249.22 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate.

Molecular Properties

Compound Nameethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate
PubChem CID165487903
Molecular FormulaC9H13F2N3O3
Molecular Weight249.22 g/mol
Exact Mass249.09
IUPAC Nameethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate
SMILESCCOC(=O)C(F)(F)Cn1cc(CCO)nn1
InChIInChI=1S/C9H13F2N3O3/c1-2-17-8(16)9(10,11)6-14-5-7(3-4-15)12-13-14/h5,15H,2-4,6H2,1H3
InChIKeyLPLMZFFHXVGQMP-UHFFFAOYSA-N
XLogP0.01
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.22
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate?
The IUPAC name of ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate (CID 165487903) is ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate.
What is the SMILES notation for ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate?
The canonical SMILES for ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate is CCOC(=O)C(F)(F)Cn1cc(CCO)nn1.
What is the InChIKey of ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate?
The InChIKey is LPLMZFFHXVGQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O3/c1-2-17-8(16)9(10,11)6-14-5-7(3-4-15)12-13-14/h5,15H,2-4,6H2,1H3.
What are the key properties of ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate?
ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate has a molecular weight of 249.22 g/mol, XLogP of 0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-3-[4-(2-hydroxyethyl)triazol-1-yl]propanoate is sourced from PubChem (CID 165487903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).