C11H17F2N3O2 — CID 165487923
ethyl 3-(4-tert-butyltriazol-1-yl)-2,2-difluoropropanoate (PubChem CID 165487923) has the molecular formula C11H17F2N3O2 and a molecular weight of 261.27 g/mol. Its IUPAC name is ethyl 3-(4-tert-butyltriazol-1-yl)-2,2-difluoropropanoate.
| Compound Name | ethyl 3-(4-tert-butyltriazol-1-yl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 165487923 |
| Molecular Formula | C11H17F2N3O2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | ethyl 3-(4-tert-butyltriazol-1-yl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)Cn1cc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C11H17F2N3O2/c1-5-18-9(17)11(12,13)7-16-6-8(14-15-16)10(2,3)4/h6H,5,7H2,1-4H3 |
| InChIKey | SFZDQIQYEVEMRA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |