C15H28N4O — CID 146153302
N-[2-(4-tert-butyltriazol-1-yl)ethyl]-2,4-dimethylpentanamide (PubChem CID 146153302) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is N-[2-(4-tert-butyltriazol-1-yl)ethyl]-2,4-dimethylpentanamide.
| Compound Name | N-[2-(4-tert-butyltriazol-1-yl)ethyl]-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 146153302 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N-[2-(4-tert-butyltriazol-1-yl)ethyl]-2,4-dimethylpentanamide |
| SMILES | CC(C)CC(C)C(=O)NCCn1cc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C15H28N4O/c1-11(2)9-12(3)14(20)16-7-8-19-10-13(17-18-19)15(4,5)6/h10-12H,7-9H2,1-6H3,(H,16,20) |
| InChIKey | WKLDZWOHOHPPGU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |