C15H20ClN5O — CID 146153347
N-[(2S)-1-(4-tert-butyltriazol-1-yl)propan-2-yl]-5-chloropyridine-3-carboxamide (PubChem CID 146153347) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is N-[(2S)-1-(4-tert-butyltriazol-1-yl)propan-2-yl]-5-chloropyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-(4-tert-butyltriazol-1-yl)propan-2-yl]-5-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 146153347 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[(2S)-1-(4-tert-butyltriazol-1-yl)propan-2-yl]-5-chloropyridine-3-carboxamide |
| SMILES | C[C@@H](Cn1cc(C(C)(C)C)nn1)NC(=O)c1cncc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN5O/c1-10(8-21-9-13(19-20-21)15(2,3)4)18-14(22)11-5-12(16)7-17-6-11/h5-7,9-10H,8H2,1-4H3,(H,18,22)/t10-/m0/s1 |
| InChIKey | CFRPGFXXIXACLS-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |