C12H24ClN5O — CID 119521711
N-(1-amino-2-methylpropan-2-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119521711) has the molecular formula C12H24ClN5O and a molecular weight of 289.81 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119521711 |
| Molecular Formula | C12H24ClN5O |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)CCn1cc(C(=O)NC(C)(C)CN)nn1.Cl |
| InChI | InChI=1S/C12H23N5O.ClH/c1-9(2)5-6-17-7-10(15-16-17)11(18)14-12(3,4)8-13;/h7,9H,5-6,8,13H2,1-4H3,(H,14,18);1H |
| InChIKey | OMCXIGLBLYFVFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |