C15H20ClN5O3 — CID 119618056
N-(6-amino-1,3-benzodioxol-5-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119618056) has the molecular formula C15H20ClN5O3 and a molecular weight of 353.81 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119618056 |
| Molecular Formula | C15H20ClN5O3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(3-methylbutyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)CCn1cc(C(=O)Nc2cc3c(cc2N)OCO3)nn1.Cl |
| InChI | InChI=1S/C15H19N5O3.ClH/c1-9(2)3-4-20-7-12(18-19-20)15(21)17-11-6-14-13(5-10(11)16)22-8-23-14;/h5-7,9H,3-4,8,16H2,1-2H3,(H,17,21);1H |
| InChIKey | KTGNIBRWRHUOOE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|