C21H17N5O3S — CID 59737393
N-(2-amino-5-thiophen-2-ylphenyl)-1-(1,3-benzodioxol-5-ylmethyl)triazole-4-carboxamide (PubChem CID 59737393) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-1-(1,3-benzodioxol-5-ylmethyl)triazole-4-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-1-(1,3-benzodioxol-5-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 59737393 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-1-(1,3-benzodioxol-5-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1cn(Cc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C21H17N5O3S/c22-15-5-4-14(20-2-1-7-30-20)9-16(15)23-21(27)17-11-26(25-24-17)10-13-3-6-18-19(8-13)29-12-28-18/h1-9,11H,10,12,22H2,(H,23,27) |
| InChIKey | LPUWQXCKCWFVRW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|