C27H26N2O3S — CID 161266214
(E)-1-(2-amino-5-thiophen-2-ylphenyl)-5-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-ylidene]pent-3-en-2-one (PubChem CID 161266214) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is (E)-1-(2-amino-5-thiophen-2-ylphenyl)-5-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-ylidene]pent-3-en-2-one.
| Compound Name | (E)-1-(2-amino-5-thiophen-2-ylphenyl)-5-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-ylidene]pent-3-en-2-one |
|---|---|
| PubChem CID | 161266214 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (E)-1-(2-amino-5-thiophen-2-ylphenyl)-5-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-ylidene]pent-3-en-2-one |
| SMILES | Nc1ccc(-c2cccs2)cc1CC(=O)/C=C/C=C1CCN(Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C27H26N2O3S/c28-24-8-7-21(27-5-2-12-33-27)14-22(24)15-23(30)4-1-3-19-10-11-29(16-19)17-20-6-9-25-26(13-20)32-18-31-25/h1-9,12-14H,10-11,15-18,28H2/b4-1+,19-3? |
| InChIKey | UVBRGWVOADKVAU-QCCRIRBNSA-N |
| XLogP | 5.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|