C18H14N4OS — CID 59736711
N-(2-amino-5-thiophen-2-ylphenyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 59736711) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59736711 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C18H14N4OS/c19-13-7-6-12(16-4-3-9-24-16)10-14(13)21-18(23)15-11-22-8-2-1-5-17(22)20-15/h1-11H,19H2,(H,21,23) |
| InChIKey | WIGFTTPWTAPMMW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|