C26H34NO4P — CID 143187382
[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-N-methyl-N-(5-oxo-4,4-diphenylheptan-2-yl)phosphonamidic acid (PubChem CID 143187382) has the molecular formula C26H34NO4P and a molecular weight of 455.54 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-3-yl]oxy-N-methyl-N-(5-oxo-4,4-diphenylheptan-2-yl)phosphonamidic acid.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-3-yl]oxy-N-methyl-N-(5-oxo-4,4-diphenylheptan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 143187382 |
| Molecular Formula | C26H34NO4P |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-3-yl]oxy-N-methyl-N-(5-oxo-4,4-diphenylheptan-2-yl)phosphonamidic acid |
| SMILES | C/C=C\C(=C/C)OP(=O)(O)N(C)C(C)CC(C(=O)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34NO4P/c1-6-15-24(7-2)31-32(29,30)27(5)21(4)20-26(25(28)8-3,22-16-11-9-12-17-22)23-18-13-10-14-19-23/h6-7,9-19,21H,8,20H2,1-5H3,(H,29,30)/b15-6-,24-7+ |
| InChIKey | JPKHRWQNDSCAAH-LSGIWYNDSA-N |
| XLogP | 6.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|