C27H39N3O2 — CID 176556984
[(E)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(2-aminobutyl)-N-methylcarbamate (PubChem CID 176556984) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is [(E)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(2-aminobutyl)-N-methylcarbamate.
| Compound Name | [(E)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(2-aminobutyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 176556984 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | [(E)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(2-aminobutyl)-N-methylcarbamate |
| SMILES | C/C=C(/OC(=O)N(C)CC(N)CC)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H39N3O2/c1-7-24(28)20-30(6)26(31)32-25(8-2)27(19-21(3)29(4)5,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h8-18,21,24H,7,19-20,28H2,1-6H3/b25-8+ |
| InChIKey | YGSOWXLGCYPWAR-ZNLRHDTNSA-N |
| XLogP | 5.02 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|