C39H53N7O4 — CID 176556970
[(E,6R)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[1-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]propan-2-yl]-N-methylcarbamate (PubChem CID 176556970) has the molecular formula C39H53N7O4 and a molecular weight of 683.90 g/mol. Its IUPAC name is [(E,6R)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[1-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]propan-2-yl]-N-methylcarbamate.
| Compound Name | [(E,6R)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[1-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 176556970 |
| Molecular Formula | C39H53N7O4 |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.42 |
| IUPAC Name | [(E,6R)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[1-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]propan-2-yl]-N-methylcarbamate |
| SMILES | C/C=C(/OC(=O)N(C)C(C)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccccc1)C(C[C@@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H53N7O4/c1-7-34(39(26-28(2)45(4)5,31-20-13-9-14-21-31)32-22-15-10-16-23-32)50-38(49)46(6)29(3)27-43-36(48)33(24-17-25-42-37(40)41)44-35(47)30-18-11-8-12-19-30/h7-16,18-23,28-29,33H,17,24-27H2,1-6H3,(H,43,48)(H,44,47)(H4,40,41,42)/b34-7+/t28-,29?,33+/m1/s1 |
| InChIKey | LGAIPZZVRLXBKN-AYOMDCGMSA-N |
| XLogP | 4.64 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|