C33H49N7O4 — CID 168757269
[(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[[4-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]morpholin-2-yl]methyl]carbamate (PubChem CID 168757269) has the molecular formula C33H49N7O4 and a molecular weight of 607.80 g/mol. Its IUPAC name is [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[[4-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]morpholin-2-yl]methyl]carbamate.
| Compound Name | [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[[4-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 168757269 |
| Molecular Formula | C33H49N7O4 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.38 |
| IUPAC Name | [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-[[4-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]morpholin-2-yl]methyl]carbamate |
| SMILES | C/C=C(\OC(=O)NCC1CN(N[C@H](C=O)CCCN=C(N)N)CCO1)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H49N7O4/c1-5-30(33(21-25(2)39(3)4,26-13-8-6-9-14-26)27-15-10-7-11-16-27)44-32(42)37-22-29-23-40(19-20-43-29)38-28(24-41)17-12-18-36-31(34)35/h5-11,13-16,24-25,28-29,38H,12,17-23H2,1-4H3,(H,37,42)(H4,34,35,36)/b30-5-/t25?,28-,29?/m0/s1 |
| InChIKey | HYRWXLMVXVFUFG-BKETYCDFSA-N |
| XLogP | 2.77 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|