C26H40N6O5 — CID 131719054
ethyl N-[(2S)-1-[(2R)-2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1-propylpyrrolidin-2-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 131719054) has the molecular formula C26H40N6O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[(2R)-2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1-propylpyrrolidin-2-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[(2R)-2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1-propylpyrrolidin-2-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 131719054 |
| Molecular Formula | C26H40N6O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | ethyl N-[(2S)-1-[(2R)-2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1-propylpyrrolidin-2-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCN1CCC[C@]1(C(=O)N[C@H](C=O)CCCN=C(N)N)C(=O)[C@H](Cc1ccccc1)NC(=O)OCC |
| InChI | InChI=1S/C26H40N6O5/c1-3-15-32-16-9-13-26(32,23(35)30-20(18-33)12-8-14-29-24(27)28)22(34)21(31-25(36)37-4-2)17-19-10-6-5-7-11-19/h5-7,10-11,18,20-21H,3-4,8-9,12-17H2,1-2H3,(H,30,35)(H,31,36)(H4,27,28,29)/t20-,21-,26+/m0/s1 |
| InChIKey | HZPXSOZQBIXRBS-ISJBWFOZSA-N |
| XLogP | 0.89 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|