C27H42N6O5 — CID 56977115
ethyl N-[(2S)-1-[(2S)-2-[(3S)-3-amino-3-[3-(diaminomethylideneamino)propyl]-2-oxoheptanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 56977115) has the molecular formula C27H42N6O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[(2S)-2-[(3S)-3-amino-3-[3-(diaminomethylideneamino)propyl]-2-oxoheptanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[(2S)-2-[(3S)-3-amino-3-[3-(diaminomethylideneamino)propyl]-2-oxoheptanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 56977115 |
| Molecular Formula | C27H42N6O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | ethyl N-[(2S)-1-[(2S)-2-[(3S)-3-amino-3-[3-(diaminomethylideneamino)propyl]-2-oxoheptanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCC[C@](N)(CCCN=C(N)N)C(=O)C(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1ccccc1)NC(=O)OCC |
| InChI | InChI=1S/C27H42N6O5/c1-3-5-14-27(30,15-10-16-31-25(28)29)23(35)22(34)21-13-9-17-33(21)24(36)20(32-26(37)38-4-2)18-19-11-7-6-8-12-19/h6-8,11-12,20-21H,3-5,9-10,13-18,30H2,1-2H3,(H,32,37)(H4,28,29,31)/t20-,21-,27-/m0/s1 |
| InChIKey | VFKNFNUTZHFWLR-IZVMNLJQSA-N |
| XLogP | 1.41 |
| TPSA | 183.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|