C25H38N6O5 — CID 57117037
ethyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-3-ethyl-1,2-dioxo-1-[(2S)-pyrrolidin-2-yl]hexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 57117037) has the molecular formula C25H38N6O5 and a molecular weight of 502.62 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-3-ethyl-1,2-dioxo-1-[(2S)-pyrrolidin-2-yl]hexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-3-ethyl-1,2-dioxo-1-[(2S)-pyrrolidin-2-yl]hexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 57117037 |
| Molecular Formula | C25H38N6O5 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | ethyl N-[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-3-ethyl-1,2-dioxo-1-[(2S)-pyrrolidin-2-yl]hexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@](CC)(CCCN=C(N)N)C(=O)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C25H38N6O5/c1-3-25(13-9-15-29-23(26)27,21(33)20(32)18-12-8-14-28-18)31-22(34)19(30-24(35)36-4-2)16-17-10-6-5-7-11-17/h5-7,10-11,18-19,28H,3-4,8-9,12-16H2,1-2H3,(H,30,35)(H,31,34)(H4,26,27,29)/t18-,19-,25-/m0/s1 |
| InChIKey | FKJIUAACLQHSIO-MHPIHPPYSA-N |
| XLogP | 0.55 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|