C23H34N6O6 — CID 163688495
benzyl N-[(2R)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(piperidine-2-carbonyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 163688495) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(piperidine-2-carbonyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(piperidine-2-carbonyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 163688495 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | benzyl N-[(2R)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(piperidine-2-carbonyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | NC(N)=NCCC[C@@H](C=O)N(C(=O)C1CCCCN1)C(=O)[C@@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H34N6O6/c24-22(25)27-12-6-9-17(13-30)29(20(32)18-10-4-5-11-26-18)21(33)19(14-31)28-23(34)35-15-16-7-2-1-3-8-16/h1-3,7-8,13,17-19,26,31H,4-6,9-12,14-15H2,(H,28,34)(H4,24,25,27)/t17-,18?,19+/m0/s1 |
| InChIKey | JQYUVGWKBRWYNV-LJJQOFDWSA-N |
| XLogP | -0.61 |
| TPSA | 189.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|