C20H30N6O4 — CID 23184423
5-(diaminomethylideneamino)-2-[2-[N-(pyrrolidine-2-carbonyl)anilino]propanoylamino]pentanoic acid (PubChem CID 23184423) has the molecular formula C20H30N6O4 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[2-[N-(pyrrolidine-2-carbonyl)anilino]propanoylamino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[2-[N-(pyrrolidine-2-carbonyl)anilino]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 23184423 |
| Molecular Formula | C20H30N6O4 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[2-[N-(pyrrolidine-2-carbonyl)anilino]propanoylamino]pentanoic acid |
| SMILES | CC(C(=O)NC(CCCN=C(N)N)C(=O)O)N(C(=O)C1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C20H30N6O4/c1-13(17(27)25-16(19(29)30)10-6-12-24-20(21)22)26(14-7-3-2-4-8-14)18(28)15-9-5-11-23-15/h2-4,7-8,13,15-16,23H,5-6,9-12H2,1H3,(H,25,27)(H,29,30)(H4,21,22,24) |
| InChIKey | PRILPOZZPOTTBS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|