C24H31N7O4 — CID 69200485
5-(diaminomethylideneamino)-2-[2-[N-[(2,3-dimethylphenyl)iminocarbamoyl]anilino]propanoylamino]pentanoic acid (PubChem CID 69200485) has the molecular formula C24H31N7O4 and a molecular weight of 481.56 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[2-[N-[(2,3-dimethylphenyl)iminocarbamoyl]anilino]propanoylamino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[2-[N-[(2,3-dimethylphenyl)iminocarbamoyl]anilino]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 69200485 |
| Molecular Formula | C24H31N7O4 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[2-[N-[(2,3-dimethylphenyl)iminocarbamoyl]anilino]propanoylamino]pentanoic acid |
| SMILES | Cc1cccc(/N=N/C(=O)N(c2ccccc2)C(C)C(=O)NC(CCCN=C(N)N)C(=O)O)c1C |
| InChI | InChI=1S/C24H31N7O4/c1-15-9-7-12-19(16(15)2)29-30-24(35)31(18-10-5-4-6-11-18)17(3)21(32)28-20(22(33)34)13-8-14-27-23(25)26/h4-7,9-12,17,20H,8,13-14H2,1-3H3,(H,28,32)(H,33,34)(H4,25,26,27)/b30-29+ |
| InChIKey | LIGRAHREHHCJLQ-QVIHXGFCSA-N |
| XLogP | 3.03 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|