C22H34N6O3 — CID 22858507
(2S)-N-[2-benzyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 22858507) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2S)-N-[2-benzyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-benzyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22858507 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2S)-N-[2-benzyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CNCC(Cc1ccccc1)C(=O)N(C(=O)[C@@H]1CCCN1)[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C22H34N6O3/c1-25-14-17(13-16-7-3-2-4-8-16)20(30)28(21(31)19-10-6-11-26-19)18(15-29)9-5-12-27-22(23)24/h2-4,7-8,15,17-19,25-26H,5-6,9-14H2,1H3,(H4,23,24,27)/t17?,18-,19-/m0/s1 |
| InChIKey | FMMFKWHBXAHWGX-MNNMKWMVSA-N |
| XLogP | -0.21 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|