C34H61ClN6O5 — CID 70524301
benzyl N-[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-(2-methylpiperidin-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride (PubChem CID 70524301) has the molecular formula C34H61ClN6O5 and a molecular weight of 669.35 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-(2-methylpiperidin-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-(2-methylpiperidin-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70524301 |
| Molecular Formula | C34H61ClN6O5 |
| Molecular Weight | 669.35 g/mol |
| Exact Mass | 668.44 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-(2-methylpiperidin-2-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
| SMILES | CCCCOC(OCCCC)[C@H](CCCN=C(N)N)N(C(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C1(C)CCCCN1.Cl |
| InChI | InChI=1S/C34H60N6O5.ClH/c1-6-8-22-43-31(44-23-9-7-2)29(18-15-20-37-32(35)36)40(34(5)19-13-14-21-38-34)30(41)28(24-26(3)4)39-33(42)45-25-27-16-11-10-12-17-27;/h10-12,16-17,26,28-29,31,38H,6-9,13-15,18-25H2,1-5H3,(H,39,42)(H4,35,36,37);1H/t28-,29-,34?;/m0./s1 |
| InChIKey | IJMIJHGGWPTHPW-FMYHPINHSA-N |
| XLogP | 5.45 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|