C21H36N8O2 — CID 70413648
(2R)-2-amino-N-[(2S)-1-[amino-(2-methylpiperidin-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide (PubChem CID 70413648) has the molecular formula C21H36N8O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2S)-1-[amino-(2-methylpiperidin-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-[(2S)-1-[amino-(2-methylpiperidin-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 70413648 |
| Molecular Formula | C21H36N8O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (2R)-2-amino-N-[(2S)-1-[amino-(2-methylpiperidin-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide |
| SMILES | CC1(N(N)C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](N)Cc2ccccc2)CCCCN1 |
| InChI | InChI=1S/C21H36N8O2/c1-21(11-5-6-13-27-21)29(25)19(31)17(10-7-12-26-20(23)24)28-18(30)16(22)14-15-8-3-2-4-9-15/h2-4,8-9,16-17,27H,5-7,10-14,22,25H2,1H3,(H,28,30)(H4,23,24,26)/t16-,17+,21?/m1/s1 |
| InChIKey | JJECLWNZIVHOEL-LXMSXWCSSA-N |
| XLogP | -0.71 |
| TPSA | 177.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|