C27H37N3O2 — CID 176556954
[(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(pyrrolidin-3-ylmethyl)carbamate (PubChem CID 176556954) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(pyrrolidin-3-ylmethyl)carbamate.
| Compound Name | [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(pyrrolidin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 176556954 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | [(Z)-6-(dimethylamino)-4,4-diphenylhept-2-en-3-yl] N-(pyrrolidin-3-ylmethyl)carbamate |
| SMILES | C/C=C(\OC(=O)NCC1CCNC1)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O2/c1-5-25(32-26(31)29-20-22-16-17-28-19-22)27(18-21(2)30(3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h5-15,21-22,28H,16-20H2,1-4H3,(H,29,31)/b25-5- |
| InChIKey | YGFDALLKNHMMIA-FISMNSNESA-N |
| XLogP | 4.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|