C27H32NO4P — CID 58600371
6-[[methoxy(phenoxy)phosphoryl]-methylamino]-4,4-diphenylheptan-3-one (PubChem CID 58600371) has the molecular formula C27H32NO4P and a molecular weight of 465.53 g/mol. Its IUPAC name is 6-[[methoxy(phenoxy)phosphoryl]-methylamino]-4,4-diphenylheptan-3-one.
| Compound Name | 6-[[methoxy(phenoxy)phosphoryl]-methylamino]-4,4-diphenylheptan-3-one |
|---|---|
| PubChem CID | 58600371 |
| Molecular Formula | C27H32NO4P |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 6-[[methoxy(phenoxy)phosphoryl]-methylamino]-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(CC(C)N(C)P(=O)(OC)Oc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32NO4P/c1-5-26(29)27(23-15-9-6-10-16-23,24-17-11-7-12-18-24)21-22(2)28(3)33(30,31-4)32-25-19-13-8-14-20-25/h6-20,22H,5,21H2,1-4H3 |
| InChIKey | ZBDXFYWXEVJWQG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|