trimethyl(trityl)phosphanium fluoride

C22H24FP — CID 18356035

IUPACtrimethyl(trityl)phosphanium fluoride
SMILESC[P+](C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1.[F-]
InChIInChI=1S/C22H24P.FH/c1-23(2,3)22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;/h4-18H,1-3H3;1H/q+1;/p-1
InChIKeyMPSPIZDWGMPJDR-UHFFFAOYSA-M
MW338.41 g/mol
LogP2.89
Rot. Bonds4

About trimethyl(trityl)phosphanium fluoride

trimethyl(trityl)phosphanium fluoride (PubChem CID 18356035) has the molecular formula C22H24FP and a molecular weight of 338.41 g/mol. Its IUPAC name is trimethyl(trityl)phosphanium fluoride.

Molecular Properties

Compound Nametrimethyl(trityl)phosphanium fluoride
PubChem CID18356035
Molecular FormulaC22H24FP
Molecular Weight338.41 g/mol
Exact Mass338.16
IUPAC Nametrimethyl(trityl)phosphanium fluoride
SMILESC[P+](C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1.[F-]
InChIInChI=1S/C22H24P.FH/c1-23(2,3)22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;/h4-18H,1-3H3;1H/q+1;/p-1
InChIKeyMPSPIZDWGMPJDR-UHFFFAOYSA-M
XLogP2.89
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.41
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}

Analyze trimethyl(trityl)phosphanium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl(trityl)phosphanium fluoride?
The IUPAC name of trimethyl(trityl)phosphanium fluoride (CID 18356035) is trimethyl(trityl)phosphanium fluoride.
What is the SMILES notation for trimethyl(trityl)phosphanium fluoride?
The canonical SMILES for trimethyl(trityl)phosphanium fluoride is C[P+](C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1.[F-].
What is the InChIKey of trimethyl(trityl)phosphanium fluoride?
The InChIKey is MPSPIZDWGMPJDR-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H24P.FH/c1-23(2,3)22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;/h4-18H,1-3H3;1H/q+1;/p-1.
What are the key properties of trimethyl(trityl)phosphanium fluoride?
trimethyl(trityl)phosphanium fluoride has a molecular weight of 338.41 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(trityl)phosphanium fluoride is sourced from PubChem (CID 18356035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).