C15H18N2 — CID 11172185
(2S)-1,1-diphenylpropane-1,2-diamine (PubChem CID 11172185) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S)-1,1-diphenylpropane-1,2-diamine.
| Compound Name | (2S)-1,1-diphenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 11172185 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2S)-1,1-diphenylpropane-1,2-diamine |
| SMILES | C[C@H](N)C(N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18N2/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,16-17H2,1H3/t12-/m0/s1 |
| InChIKey | OWUQWDCZCOJEKU-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |