C22H24N2 — CID 67601655
2-N,2-N,2-triphenylbutane-2,3-diamine (PubChem CID 67601655) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-N,2-N,2-triphenylbutane-2,3-diamine.
| Compound Name | 2-N,2-N,2-triphenylbutane-2,3-diamine |
|---|---|
| PubChem CID | 67601655 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-N,2-N,2-triphenylbutane-2,3-diamine |
| SMILES | CC(N)C(C)(c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2/c1-18(23)22(2,19-12-6-3-7-13-19)24(20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,23H2,1-2H3 |
| InChIKey | VTKMTWOBVBNLJQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |