About N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline
N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline (PubChem CID 174956285) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline.
Molecular Properties
| Compound Name | N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline |
| PubChem CID | 174956285 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline |
| SMILES | CC(C)(C)C(C)(C)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-18(2,3)19(4,5)20(16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15H,1-5H3 |
| InChIKey | LYGOHCPGJLUYIV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline?
The IUPAC name of N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline (CID 174956285) is N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline.
What is the SMILES notation for N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline?
The canonical SMILES for N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline is CC(C)(C)C(C)(C)N(c1ccccc1)c1ccccc1.
What is the InChIKey of N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline?
The InChIKey is LYGOHCPGJLUYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N/c1-18(2,3)19(4,5)20(16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15H,1-5H3.
What are the key properties of N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline?
N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline has a molecular weight of 267.42 g/mol, XLogP of 5.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline is sourced from PubChem (CID 174956285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).