C19H25N — CID 174956285
N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline (PubChem CID 174956285) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline.
| Compound Name | N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 174956285 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-phenyl-N-(2,3,3-trimethylbutan-2-yl)aniline |
| SMILES | CC(C)(C)C(C)(C)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-18(2,3)19(4,5)20(16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15H,1-5H3 |
| InChIKey | LYGOHCPGJLUYIV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |