C30H33N2P — CID 143197481
2-methyl-2-N,2-N,4-N,4-N-tetraphenyl-4-phosphanylpentane-2,4-diamine (PubChem CID 143197481) has the molecular formula C30H33N2P and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-methyl-2-N,2-N,4-N,4-N-tetraphenyl-4-phosphanylpentane-2,4-diamine.
| Compound Name | 2-methyl-2-N,2-N,4-N,4-N-tetraphenyl-4-phosphanylpentane-2,4-diamine |
|---|---|
| PubChem CID | 143197481 |
| Molecular Formula | C30H33N2P |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-methyl-2-N,2-N,4-N,4-N-tetraphenyl-4-phosphanylpentane-2,4-diamine |
| SMILES | CC(C)(CC(C)(P)N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33N2P/c1-29(2,31(25-16-8-4-9-17-25)26-18-10-5-11-19-26)24-30(3,33)32(27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-23H,24,33H2,1-3H3 |
| InChIKey | NUTNREXHSMLKQC-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|