C28H29N3O — CID 93010917
(2R,3S)-1-imidazol-1-yl-3-methyl-2-(tritylamino)pentan-1-one (PubChem CID 93010917) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is (2R,3S)-1-imidazol-1-yl-3-methyl-2-(tritylamino)pentan-1-one.
| Compound Name | (2R,3S)-1-imidazol-1-yl-3-methyl-2-(tritylamino)pentan-1-one |
|---|---|
| PubChem CID | 93010917 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (2R,3S)-1-imidazol-1-yl-3-methyl-2-(tritylamino)pentan-1-one |
| SMILES | CC[C@H](C)[C@@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)n1ccnc1 |
| InChI | InChI=1S/C28H29N3O/c1-3-22(2)26(27(32)31-20-19-29-21-31)30-28(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-22,26,30H,3H2,1-2H3/t22-,26+/m0/s1 |
| InChIKey | XGBOXQUTPFMYLI-BKMJKUGQSA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|