About N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide
N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide (PubChem CID 155280807) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide.
Molecular Properties
| Compound Name | N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide |
| PubChem CID | 155280807 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide |
| SMILES | CCC(C)N(C(=O)n1ccnc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16N4O3/c1-3-11(2)19(16(23)18-9-8-17-10-18)20-14(21)12-6-4-5-7-13(12)15(20)22/h4-11H,3H2,1-2H3 |
| InChIKey | HETDUAYOTWMKDF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide?
The IUPAC name of N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide (CID 155280807) is N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide.
What is the SMILES notation for N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide?
The canonical SMILES for N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide is CCC(C)N(C(=O)n1ccnc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide?
The InChIKey is HETDUAYOTWMKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-3-11(2)19(16(23)18-9-8-17-10-18)20-14(21)12-6-4-5-7-13(12)15(20)22/h4-11H,3H2,1-2H3.
What are the key properties of N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide?
N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide has a molecular weight of 312.33 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N-(1,3-dioxoisoindol-2-yl)imidazole-1-carboxamide is sourced from PubChem (CID 155280807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).