C46H40N2O7 — CID 102015733
[4-[[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-bis(4-benzoyloxyphenyl)methyl]phenyl] benzoate (PubChem CID 102015733) has the molecular formula C46H40N2O7 and a molecular weight of 732.83 g/mol. Its IUPAC name is [4-[[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-bis(4-benzoyloxyphenyl)methyl]phenyl] benzoate.
| Compound Name | [4-[[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-bis(4-benzoyloxyphenyl)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 102015733 |
| Molecular Formula | C46H40N2O7 |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.28 |
| IUPAC Name | [4-[[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-bis(4-benzoyloxyphenyl)methyl]phenyl] benzoate |
| SMILES | CC[C@H](C)[C@H](NC(c1ccc(OC(=O)c2ccccc2)cc1)(c1ccc(OC(=O)c2ccccc2)cc1)c1ccc(OC(=O)c2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C46H40N2O7/c1-3-31(2)41(42(47)49)48-46(35-19-25-38(26-20-35)53-43(50)32-13-7-4-8-14-32,36-21-27-39(28-22-36)54-44(51)33-15-9-5-10-16-33)37-23-29-40(30-24-37)55-45(52)34-17-11-6-12-18-34/h4-31,41,48H,3H2,1-2H3,(H2,47,49)/t31-,41-/m0/s1 |
| InChIKey | GMEJGLHKRYQVRV-BMWXWXOGSA-N |
| XLogP | 8.13 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|