C14H19NO6 — CID 43353625
3-hydroxy-2-[2-(4-methoxyphenoxy)propanoylamino]butanoic acid (PubChem CID 43353625) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-hydroxy-2-[2-(4-methoxyphenoxy)propanoylamino]butanoic acid.
| Compound Name | 3-hydroxy-2-[2-(4-methoxyphenoxy)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43353625 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-hydroxy-2-[2-(4-methoxyphenoxy)propanoylamino]butanoic acid |
| SMILES | COc1ccc(OC(C)C(=O)NC(C(=O)O)C(C)O)cc1 |
| InChI | InChI=1S/C14H19NO6/c1-8(16)12(14(18)19)15-13(17)9(2)21-11-6-4-10(20-3)5-7-11/h4-9,12,16H,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | OVIXLXZVILHDEQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |