About sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate
sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate (PubChem CID 123878920) has the molecular formula C9H12O4S2
and a molecular weight of 250.33 g/mol. Its IUPAC name is sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate |
| PubChem CID | 123878920 |
| Molecular Formula | C9H12O4S2 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate |
| SMILES | O=S.[3H]CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H12O3S.OS/c1-3-12-13(10,11)9-6-4-8(2)5-7-9;1-2/h4-7H,3H2,1-2H3;/i1T; |
| InChIKey | HOJNOBODJKFGGC-PXDSPCEXSA-N |
| XLogP | 1.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate?
The IUPAC name of sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate (CID 123878920) is sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate.
What is the SMILES notation for sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate?
The canonical SMILES for sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate is O=S.[3H]CCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate?
The InChIKey is HOJNOBODJKFGGC-PXDSPCEXSA-N. The full InChI is InChI=1S/C9H12O3S.OS/c1-3-12-13(10,11)9-6-4-8(2)5-7-9;1-2/h4-7H,3H2,1-2H3;/i1T;.
What are the key properties of sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate?
sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate has a molecular weight of 250.33 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur monoxide;2-tritioethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 123878920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).