C29H40O4Si — CID 10767091
tert-butyl [(2S,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-yn-3-yl] carbonate (PubChem CID 10767091) has the molecular formula C29H40O4Si and a molecular weight of 480.72 g/mol. Its IUPAC name is tert-butyl [(2S,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-yn-3-yl] carbonate.
| Compound Name | tert-butyl [(2S,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-yn-3-yl] carbonate |
|---|---|
| PubChem CID | 10767091 |
| Molecular Formula | C29H40O4Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | tert-butyl [(2S,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-yn-3-yl] carbonate |
| SMILES | C#C[C@H](C)[C@H](OC(=O)OC(C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40O4Si/c1-10-22(2)26(32-27(30)33-28(4,5)6)23(3)21-31-34(29(7,8)9,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h1,11-20,22-23,26H,21H2,2-9H3/t22-,23-,26-/m0/s1 |
| InChIKey | UVVNRCLVXKINKP-FXSPECFOSA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|