C31H41NO2Si — CID 10743595
N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dimethylbenzamide (PubChem CID 10743595) has the molecular formula C31H41NO2Si and a molecular weight of 487.76 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dimethylbenzamide.
| Compound Name | N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 10743595 |
| Molecular Formula | C31H41NO2Si |
| Molecular Weight | 487.76 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)N(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C31H41NO2Si/c1-24-19-20-25(2)28(23-24)29(33)32(30(3,4)5)21-22-34-35(31(6,7)8,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h9-20,23H,21-22H2,1-8H3 |
| InChIKey | HXDNFRCDCCVAKA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|