C18H24F8O3Si — CID 87256321
diethoxy-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]-phenylsilane (PubChem CID 87256321) has the molecular formula C18H24F8O3Si and a molecular weight of 468.46 g/mol. Its IUPAC name is diethoxy-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]-phenylsilane.
| Compound Name | diethoxy-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]-phenylsilane |
|---|---|
| PubChem CID | 87256321 |
| Molecular Formula | C18H24F8O3Si |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | diethoxy-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]-phenylsilane |
| SMILES | CCO[Si](CCCOC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)(OCC)c1ccccc1 |
| InChI | InChI=1S/C18H24F8O3Si/c1-4-28-30(29-5-2,14-10-7-6-8-11-14)13-9-12-27-18(25,26)17(23,24)16(21,22)15(3,19)20/h6-8,10-11H,4-5,9,12-13H2,1-3H3 |
| InChIKey | JUFIYTKXQWWLGS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|