C26H26F24O3 — CID 57032633
1-[5-[6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptoxy)hex-1-en-2-yloxy]hex-5-enoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane (PubChem CID 57032633) has the molecular formula C26H26F24O3 and a molecular weight of 842.44 g/mol. Its IUPAC name is 1-[5-[6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptoxy)hex-1-en-2-yloxy]hex-5-enoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane.
| Compound Name | 1-[5-[6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptoxy)hex-1-en-2-yloxy]hex-5-enoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
|---|---|
| PubChem CID | 57032633 |
| Molecular Formula | C26H26F24O3 |
| Molecular Weight | 842.44 g/mol |
| Exact Mass | 842.15 |
| IUPAC Name | 1-[5-[6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptoxy)hex-1-en-2-yloxy]hex-5-enoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
| SMILES | C=C(CCCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)OC(=C)CCCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C26H26F24O3/c1-13(9-5-7-11-51-25(47,48)23(43,44)21(39,40)19(35,36)17(31,32)15(3,27)28)53-14(2)10-6-8-12-52-26(49,50)24(45,46)22(41,42)20(37,38)18(33,34)16(4,29)30/h1-2,5-12H2,3-4H3 |
| InChIKey | BFWNPGKKFRTVSR-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.44 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|