C32H73NO13Si4 — CID 161095744
N-methyl-5-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]pentanamide (PubChem CID 161095744) has the molecular formula C32H73NO13Si4 and a molecular weight of 792.27 g/mol. Its IUPAC name is N-methyl-5-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]pentanamide.
| Compound Name | N-methyl-5-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]pentanamide |
|---|---|
| PubChem CID | 161095744 |
| Molecular Formula | C32H73NO13Si4 |
| Molecular Weight | 792.27 g/mol |
| Exact Mass | 791.42 |
| IUPAC Name | N-methyl-5-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]pentanamide |
| SMILES | CO[Si](CCCCC(=O)N(C)CC(CCCC[Si](OC)(OC)OC)(CCCC[Si](OC)(OC)OC)CCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C32H73NO13Si4/c1-33(31(34)22-14-18-26-47(35-2,36-3)37-4)30-32(23-15-19-27-48(38-5,39-6)40-7,24-16-20-28-49(41-8,42-9)43-10)25-17-21-29-50(44-11,45-12)46-13/h14-30H2,1-13H3 |
| InChIKey | PORRKCBPICISLK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 131.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.27 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|