C40H91NO16Si5 — CID 158282154
N-methyl-6-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]-2-(4-trimethoxysilylbutyl)hexanamide (PubChem CID 158282154) has the molecular formula C40H91NO16Si5 and a molecular weight of 982.59 g/mol. Its IUPAC name is N-methyl-6-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]-2-(4-trimethoxysilylbutyl)hexanamide.
| Compound Name | N-methyl-6-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]-2-(4-trimethoxysilylbutyl)hexanamide |
|---|---|
| PubChem CID | 158282154 |
| Molecular Formula | C40H91NO16Si5 |
| Molecular Weight | 982.59 g/mol |
| Exact Mass | 981.52 |
| IUPAC Name | N-methyl-6-trimethoxysilyl-N-[6-trimethoxysilyl-2,2-bis(4-trimethoxysilylbutyl)hexyl]-2-(4-trimethoxysilylbutyl)hexanamide |
| SMILES | CO[Si](CCCCC(CCCC[Si](OC)(OC)OC)C(=O)N(C)CC(CCCC[Si](OC)(OC)OC)(CCCC[Si](OC)(OC)OC)CCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C40H91NO16Si5/c1-41(39(42)38(27-17-22-32-58(43-2,44-3)45-4)28-18-23-33-59(46-5,47-6)48-7)37-40(29-19-24-34-60(49-8,50-9)51-10,30-20-25-35-61(52-11,53-12)54-13)31-21-26-36-62(55-14,56-15)57-16/h38H,17-37H2,1-16H3 |
| InChIKey | GLBBAEVETDWNDH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 158.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|