C24H56O11Si3 — CID 157238818
4-[5-trimethoxysilyl-2,2-bis(3-trimethoxysilylpropyl)pentoxy]butan-2-ol (PubChem CID 157238818) has the molecular formula C24H56O11Si3 and a molecular weight of 604.96 g/mol. Its IUPAC name is 4-[5-trimethoxysilyl-2,2-bis(3-trimethoxysilylpropyl)pentoxy]butan-2-ol.
| Compound Name | 4-[5-trimethoxysilyl-2,2-bis(3-trimethoxysilylpropyl)pentoxy]butan-2-ol |
|---|---|
| PubChem CID | 157238818 |
| Molecular Formula | C24H56O11Si3 |
| Molecular Weight | 604.96 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 4-[5-trimethoxysilyl-2,2-bis(3-trimethoxysilylpropyl)pentoxy]butan-2-ol |
| SMILES | CO[Si](CCCC(CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)COCCC(C)O)(OC)OC |
| InChI | InChI=1S/C24H56O11Si3/c1-23(25)14-18-35-22-24(15-11-19-36(26-2,27-3)28-4,16-12-20-37(29-5,30-6)31-7)17-13-21-38(32-8,33-9)34-10/h23,25H,11-22H2,1-10H3 |
| InChIKey | OFWYFGHDXCLGTK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|