C18H38O4 — CID 175058110
4-(1,5-dibutoxy-3-methylpentan-3-yl)oxybutan-2-ol (PubChem CID 175058110) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 4-(1,5-dibutoxy-3-methylpentan-3-yl)oxybutan-2-ol.
| Compound Name | 4-(1,5-dibutoxy-3-methylpentan-3-yl)oxybutan-2-ol |
|---|---|
| PubChem CID | 175058110 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 4-(1,5-dibutoxy-3-methylpentan-3-yl)oxybutan-2-ol |
| SMILES | CCCCOCCC(C)(CCOCCCC)OCCC(C)O |
| InChI | InChI=1S/C18H38O4/c1-5-7-12-20-15-10-18(4,22-14-9-17(3)19)11-16-21-13-8-6-2/h17,19H,5-16H2,1-4H3 |
| InChIKey | FYNCYRNTKBWZEN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|