C12H30N2O3Si — CID 174995440
3-ethyl-7-trimethoxysilylheptane-3,4-diamine (PubChem CID 174995440) has the molecular formula C12H30N2O3Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 3-ethyl-7-trimethoxysilylheptane-3,4-diamine.
| Compound Name | 3-ethyl-7-trimethoxysilylheptane-3,4-diamine |
|---|---|
| PubChem CID | 174995440 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3-ethyl-7-trimethoxysilylheptane-3,4-diamine |
| SMILES | CCC(N)(CC)C(N)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H30N2O3Si/c1-6-12(14,7-2)11(13)9-8-10-18(15-3,16-4)17-5/h11H,6-10,13-14H2,1-5H3 |
| InChIKey | KMOKWZTWEOOGHF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|