C24H50N2 — CID 54511499
3-ethyldocos-13-ene-3,4-diamine (PubChem CID 54511499) has the molecular formula C24H50N2 and a molecular weight of 366.68 g/mol. Its IUPAC name is 3-ethyldocos-13-ene-3,4-diamine.
| Compound Name | 3-ethyldocos-13-ene-3,4-diamine |
|---|---|
| PubChem CID | 54511499 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | 3-ethyldocos-13-ene-3,4-diamine |
| SMILES | CCCCCCCCC=CCCCCCCCCC(N)C(N)(CC)CC |
| InChI | InChI=1S/C24H50N2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)24(26,5-2)6-3/h13-14,23H,4-12,15-22,25-26H2,1-3H3 |
| InChIKey | YJLKXZUJNSHBOO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|